![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 2. Adopt a Highway 2019.WEB-DL.srt | 2025-10-09 01:00 | 66K | |
| 10. A Million Ways To Die In The West 2014 WEBRip HC 900 MB ---- Translated by Matin ( Worldsubtitle.com ).srt | 2025-08-24 01:20 | 111K | |
| 1. Sunrise.In.Heaven.2019.1080p.WEB-DL.DD5.1.H264-FGT1.srt | 2025-08-21 00:31 | 112K | |
| 8. A.Million.Ways.To.Die.In.The.West.2014.720p.HDRiP.X264.AC3.5.1-PLAYNOW.srt | 2025-08-24 01:20 | 120K | |
| 7. A.Million.Ways.to.Die.in.the.West.2014.HDRip.X264.AC3.5.1-PLAYNOW_IranFilm.srt | 2025-08-24 01:20 | 126K | |
| 6. A Million Ways To Die In The West 2014 WEBRip.srt | 2025-08-24 01:20 | 127K | |
| 1. Main.Prem.Ki.Diwani.Hoon.2003.720p.WebDL.Fa.srt | 2025-09-21 00:44 | 143K | |
| 4. Just.Mercy.2019.WEB-DL.x264-FGT_By Hosein Ghazinoury.srt | 2025-10-14 01:09 | 169K | |
| 2. The.Gentlemen.2019.1080p.WEBRip.x264.AAC5.Farsi.ass | 2025-08-18 01:38 | 197K | |
| 9. A Million Ways To Die In The West 2014.720p HDRip .srt | 2025-08-24 01:20 | 228K | |